5,5-bis(ethylamino)-2-methylpent-2-enoic acid

C10H20N2O2 — CID 91263561

IUPAC5,5-bis(ethylamino)-2-methylpent-2-enoic acid
SMILESCCNC(CC=C(C)C(=O)O)NCC
InChIInChI=1S/C10H20N2O2/c1-4-11-9(12-5-2)7-6-8(3)10(13)14/h6,9,11-12H,4-5,7H2,1-3H3,(H,13,14)
InChIKeyHKTNSZRPFSPMRT-UHFFFAOYSA-N
MW200.28 g/mol
LogP0.95
Rot. Bonds7

About 5,5-bis(ethylamino)-2-methylpent-2-enoic acid

5,5-bis(ethylamino)-2-methylpent-2-enoic acid (PubChem CID 91263561) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5,5-bis(ethylamino)-2-methylpent-2-enoic acid.

Molecular Properties

Compound Name5,5-bis(ethylamino)-2-methylpent-2-enoic acid
PubChem CID91263561
Molecular FormulaC10H20N2O2
Molecular Weight200.28 g/mol
Exact Mass200.15
IUPAC Name5,5-bis(ethylamino)-2-methylpent-2-enoic acid
SMILESCCNC(CC=C(C)C(=O)O)NCC
InChIInChI=1S/C10H20N2O2/c1-4-11-9(12-5-2)7-6-8(3)10(13)14/h6,9,11-12H,4-5,7H2,1-3H3,(H,13,14)
InChIKeyHKTNSZRPFSPMRT-UHFFFAOYSA-N
XLogP0.95
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.28
LogP ≤ 50.95
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 5,5-bis(ethylamino)-2-methylpent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-bis(ethylamino)-2-methylpent-2-enoic acid?
The IUPAC name of 5,5-bis(ethylamino)-2-methylpent-2-enoic acid (CID 91263561) is 5,5-bis(ethylamino)-2-methylpent-2-enoic acid.
What is the SMILES notation for 5,5-bis(ethylamino)-2-methylpent-2-enoic acid?
The canonical SMILES for 5,5-bis(ethylamino)-2-methylpent-2-enoic acid is CCNC(CC=C(C)C(=O)O)NCC.
What is the InChIKey of 5,5-bis(ethylamino)-2-methylpent-2-enoic acid?
The InChIKey is HKTNSZRPFSPMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-4-11-9(12-5-2)7-6-8(3)10(13)14/h6,9,11-12H,4-5,7H2,1-3H3,(H,13,14).
What are the key properties of 5,5-bis(ethylamino)-2-methylpent-2-enoic acid?
5,5-bis(ethylamino)-2-methylpent-2-enoic acid has a molecular weight of 200.28 g/mol, XLogP of 0.95, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(ethylamino)-2-methylpent-2-enoic acid is sourced from PubChem (CID 91263561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).