C4H8F3N3O — CID 161240070
guanidine;1,1,1-trifluoropropan-2-one (PubChem CID 161240070) has the molecular formula C4H8F3N3O and a molecular weight of 171.12 g/mol. Its IUPAC name is guanidine;1,1,1-trifluoropropan-2-one.
| Compound Name | guanidine;1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 161240070 |
| Molecular Formula | C4H8F3N3O |
| Molecular Weight | 171.12 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | guanidine;1,1,1-trifluoropropan-2-one |
| SMILES | CC(=O)C(F)(F)F.[H]N=C(N)N |
| InChI | InChI=1S/C3H3F3O.CH5N3/c1-2(7)3(4,5)6;2-1(3)4/h1H3;(H5,2,3,4) |
| InChIKey | UZWLUUCTUBJMCS-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.12 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|