C11H21NO4 — CID 139943346
(E)-5-(2-ethoxyethoxy)-4-hydroxy-2,4-dimethylpent-2-enamide (PubChem CID 139943346) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is (E)-5-(2-ethoxyethoxy)-4-hydroxy-2,4-dimethylpent-2-enamide.
| Compound Name | (E)-5-(2-ethoxyethoxy)-4-hydroxy-2,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 139943346 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | (E)-5-(2-ethoxyethoxy)-4-hydroxy-2,4-dimethylpent-2-enamide |
| SMILES | CCOCCOCC(C)(O)/C=C(\C)C(N)=O |
| InChI | InChI=1S/C11H21NO4/c1-4-15-5-6-16-8-11(3,14)7-9(2)10(12)13/h7,14H,4-6,8H2,1-3H3,(H2,12,13)/b9-7+ |
| InChIKey | OIJZVKUGTNVXSO-VQHVLOKHSA-N |
| XLogP | 0.22 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|