C13H18F10O — CID 89135339
2-[difluoro-(1,1,1-trifluoro-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane (PubChem CID 89135339) has the molecular formula C13H18F10O and a molecular weight of 380.27 g/mol. Its IUPAC name is 2-[difluoro-(1,1,1-trifluoro-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane.
| Compound Name | 2-[difluoro-(1,1,1-trifluoro-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
|---|---|
| PubChem CID | 89135339 |
| Molecular Formula | C13H18F10O |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-[difluoro-(1,1,1-trifluoro-3-methylpentan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylpentane |
| SMILES | CCC(C)(CC(F)(F)F)OC(F)(F)C(F)(C(F)(F)F)C(C)(F)CC |
| InChI | InChI=1S/C13H18F10O/c1-5-8(3,7-10(15,16)17)24-13(22,23)11(18,12(19,20)21)9(4,14)6-2/h5-7H2,1-4H3 |
| InChIKey | MFFWGYPUDNPACB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |