C16H23F11O — CID 118228733
2-[difluoro-(1,1,1,2-tetrafluoro-2,3-dimethylhexan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylhexane (PubChem CID 118228733) has the molecular formula C16H23F11O and a molecular weight of 440.34 g/mol. Its IUPAC name is 2-[difluoro-(1,1,1,2-tetrafluoro-2,3-dimethylhexan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylhexane.
| Compound Name | 2-[difluoro-(1,1,1,2-tetrafluoro-2,3-dimethylhexan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylhexane |
|---|---|
| PubChem CID | 118228733 |
| Molecular Formula | C16H23F11O |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[difluoro-(1,1,1,2-tetrafluoro-2,3-dimethylhexan-3-yl)oxymethyl]-1,1,1,2,3-pentafluoro-3-methylhexane |
| SMILES | CCCC(C)(F)C(F)(C(F)(F)F)C(F)(F)OC(C)(CCC)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C16H23F11O/c1-6-8-10(3,17)13(19,15(23,24)25)16(26,27)28-11(4,9-7-2)12(5,18)14(20,21)22/h6-9H2,1-5H3 |
| InChIKey | TZJFLKUPAJCCKP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |