C6H4Cl2F6 — CID 154388896
1,3-dichloro-1,2,3,4,4,6-hexafluorohex-1-ene (PubChem CID 154388896) has the molecular formula C6H4Cl2F6 and a molecular weight of 260.99 g/mol. Its IUPAC name is 1,3-dichloro-1,2,3,4,4,6-hexafluorohex-1-ene.
| Compound Name | 1,3-dichloro-1,2,3,4,4,6-hexafluorohex-1-ene |
|---|---|
| PubChem CID | 154388896 |
| Molecular Formula | C6H4Cl2F6 |
| Molecular Weight | 260.99 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 1,3-dichloro-1,2,3,4,4,6-hexafluorohex-1-ene |
| SMILES | FCCC(F)(F)C(F)(Cl)C(F)=C(F)Cl |
| InChI | InChI=1S/C6H4Cl2F6/c7-4(11)3(10)6(8,14)5(12,13)1-2-9/h1-2H2 |
| InChIKey | IGQDVRVKRQDBQB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.99 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|