C5H2ClF7 — CID 146624735
1-chloro-1,2,3,3,4,5,5-heptafluoropent-1-ene (PubChem CID 146624735) has the molecular formula C5H2ClF7 and a molecular weight of 230.51 g/mol. Its IUPAC name is 1-chloro-1,2,3,3,4,5,5-heptafluoropent-1-ene.
| Compound Name | 1-chloro-1,2,3,3,4,5,5-heptafluoropent-1-ene |
|---|---|
| PubChem CID | 146624735 |
| Molecular Formula | C5H2ClF7 |
| Molecular Weight | 230.51 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 1-chloro-1,2,3,3,4,5,5-heptafluoropent-1-ene |
| SMILES | FC(Cl)=C(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C5H2ClF7/c6-3(9)1(7)5(12,13)2(8)4(10)11/h2,4H |
| InChIKey | JJMMLTIXOPXEMU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |