C5H3F7O — CID 20802177
1,1,1,2,3,3-hexafluoro-3-(1-fluoroethenoxy)propane (PubChem CID 20802177) has the molecular formula C5H3F7O and a molecular weight of 212.06 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(1-fluoroethenoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(1-fluoroethenoxy)propane |
|---|---|
| PubChem CID | 20802177 |
| Molecular Formula | C5H3F7O |
| Molecular Weight | 212.06 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(1-fluoroethenoxy)propane |
| SMILES | C=C(F)OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F7O/c1-2(6)13-5(11,12)3(7)4(8,9)10/h3H,1H2 |
| InChIKey | HMMGNTVSWLWCJF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.06 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|