C5HF9O — CID 6365941
1,1,2,2,3,3-hexafluoro-1-(1,2,2-trifluoroethenoxy)propane (PubChem CID 6365941) has the molecular formula C5HF9O and a molecular weight of 248.04 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-1-(1,2,2-trifluoroethenoxy)propane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-1-(1,2,2-trifluoroethenoxy)propane |
|---|---|
| PubChem CID | 6365941 |
| Molecular Formula | C5HF9O |
| Molecular Weight | 248.04 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-1-(1,2,2-trifluoroethenoxy)propane |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C5HF9O/c6-1(7)2(8)15-5(13,14)4(11,12)3(9)10/h3H |
| InChIKey | ZCOLNYMULWIGPK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.04 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|