C9F16O4 — CID 175691538
1-[2-[difluoro(1,2,2-trifluoroethenoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane (PubChem CID 175691538) has the molecular formula C9F16O4 and a molecular weight of 476.06 g/mol. Its IUPAC name is 1-[2-[difluoro(1,2,2-trifluoroethenoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane.
| Compound Name | 1-[2-[difluoro(1,2,2-trifluoroethenoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane |
|---|---|
| PubChem CID | 175691538 |
| Molecular Formula | C9F16O4 |
| Molecular Weight | 476.06 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | 1-[2-[difluoro(1,2,2-trifluoroethenoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethane |
| SMILES | FC(F)=C(F)OC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C9F16O4/c10-1(11)3(14)26-5(16,17)6(18,19)28-7(20,21)8(22,23)29-9(24,25)27-4(15)2(12)13 |
| InChIKey | GBSKXAMKJOQSQP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.06 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|