C8F15IO2 — CID 175689779
1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2-tetrafluoro-2-iodoethoxy)-4-(1,2,2-trifluoroethenoxy)butane (PubChem CID 175689779) has the molecular formula C8F15IO2 and a molecular weight of 539.96 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2-tetrafluoro-2-iodoethoxy)-4-(1,2,2-trifluoroethenoxy)butane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2-tetrafluoro-2-iodoethoxy)-4-(1,2,2-trifluoroethenoxy)butane |
|---|---|
| PubChem CID | 175689779 |
| Molecular Formula | C8F15IO2 |
| Molecular Weight | 539.96 g/mol |
| Exact Mass | 539.87 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2-tetrafluoro-2-iodoethoxy)-4-(1,2,2-trifluoroethenoxy)butane |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)I |
| InChI | InChI=1S/C8F15IO2/c9-1(10)2(11)25-6(18,19)3(12,13)4(14,15)7(20,21)26-8(22,23)5(16,17)24 |
| InChIKey | BGDVFBXGBXEEER-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.96 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|