C7F11KO4 — CID 122684174
potassium 2,3,3,3-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethoxy]propanoate (PubChem CID 122684174) has the molecular formula C7F11KO4 and a molecular weight of 396.15 g/mol. Its IUPAC name is potassium 2,3,3,3-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethoxy]propanoate.
| Compound Name | potassium 2,3,3,3-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 122684174 |
| Molecular Formula | C7F11KO4 |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | potassium 2,3,3,3-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethoxy]propanoate |
| SMILES | O=C([O-])C(F)(OC(F)(F)C(F)(F)OC(F)=C(F)F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C7HF11O4.K/c8-1(9)2(10)21-6(15,16)7(17,18)22-4(11,3(19)20)5(12,13)14;/h(H,19,20);/q;+1/p-1 |
| InChIKey | KSQLBJDPYNEVBE-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|