C4Cl3F5 — CID 54297906
1,2,4-trichloro-1,1,3,4,4-pentafluorobut-2-ene (PubChem CID 54297906) has the molecular formula C4Cl3F5 and a molecular weight of 249.39 g/mol. Its IUPAC name is 1,2,4-trichloro-1,1,3,4,4-pentafluorobut-2-ene.
| Compound Name | 1,2,4-trichloro-1,1,3,4,4-pentafluorobut-2-ene |
|---|---|
| PubChem CID | 54297906 |
| Molecular Formula | C4Cl3F5 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 247.90 |
| IUPAC Name | 1,2,4-trichloro-1,1,3,4,4-pentafluorobut-2-ene |
| SMILES | FC(=C(Cl)C(F)(F)Cl)C(F)(F)Cl |
| InChI | InChI=1S/C4Cl3F5/c5-1(3(6,9)10)2(8)4(7,11)12 |
| InChIKey | SCBJPTOGFNBXCH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|