C4ClF8N — CID 86175552
2-chloro-1,2-difluoro-N,N-bis(trifluoromethyl)ethenamine (PubChem CID 86175552) has the molecular formula C4ClF8N and a molecular weight of 249.49 g/mol. Its IUPAC name is 2-chloro-1,2-difluoro-N,N-bis(trifluoromethyl)ethenamine.
| Compound Name | 2-chloro-1,2-difluoro-N,N-bis(trifluoromethyl)ethenamine |
|---|---|
| PubChem CID | 86175552 |
| Molecular Formula | C4ClF8N |
| Molecular Weight | 249.49 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 2-chloro-1,2-difluoro-N,N-bis(trifluoromethyl)ethenamine |
| SMILES | FC(Cl)=C(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4ClF8N/c5-1(6)2(7)14(3(8,9)10)4(11,12)13 |
| InChIKey | YUJFPUUKGJJAMV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|