C2H4ClF3Si — CID 159523303
1-chloro-1,2,2-trifluoroethene;silane (PubChem CID 159523303) has the molecular formula C2H4ClF3Si and a molecular weight of 148.59 g/mol. Its IUPAC name is 1-chloro-1,2,2-trifluoroethene;silane.
| Compound Name | 1-chloro-1,2,2-trifluoroethene;silane |
|---|---|
| PubChem CID | 159523303 |
| Molecular Formula | C2H4ClF3Si |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 147.97 |
| IUPAC Name | 1-chloro-1,2,2-trifluoroethene;silane |
| SMILES | FC(F)=C(F)Cl.[SiH4] |
| InChI | InChI=1S/C2ClF3.H4Si/c3-1(4)2(5)6;/h;1H4 |
| InChIKey | MCBSOBCQYNCVIF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|