C4H2ClF3O — CID 159920563
1-chloro-1,2,2-trifluoroethene;ethenone (PubChem CID 159920563) has the molecular formula C4H2ClF3O and a molecular weight of 158.51 g/mol. Its IUPAC name is 1-chloro-1,2,2-trifluoroethene;ethenone.
| Compound Name | 1-chloro-1,2,2-trifluoroethene;ethenone |
|---|---|
| PubChem CID | 159920563 |
| Molecular Formula | C4H2ClF3O |
| Molecular Weight | 158.51 g/mol |
| Exact Mass | 157.97 |
| IUPAC Name | 1-chloro-1,2,2-trifluoroethene;ethenone |
| SMILES | C=C=O.FC(F)=C(F)Cl |
| InChI | InChI=1S/C2ClF3.C2H2O/c3-1(4)2(5)6;1-2-3/h;1H2 |
| InChIKey | NYIODTPKSUXRSH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|