About CID 18458589
CID 18458589 (PubChem CID 18458589) has the molecular formula C2BF3
and a molecular weight of 91.83 g/mol.
Molecular Properties
| Compound Name | CID 18458589 |
| PubChem CID | 18458589 |
| Molecular Formula | C2BF3 |
| Molecular Weight | 91.83 g/mol |
| Exact Mass | 92.00 |
| IUPAC Name | — |
| SMILES | [B]C(F)=C(F)F |
| InChI | InChI=1S/C2BF3/c3-1(4)2(5)6 |
| InChIKey | HZEKCUUSYSXIRX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.83 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18458589 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18458589?
The IUPAC name of CID 18458589 (CID 18458589) is not available.
What is the SMILES notation for CID 18458589?
The canonical SMILES for CID 18458589 is [B]C(F)=C(F)F.
What is the InChIKey of CID 18458589?
The InChIKey is HZEKCUUSYSXIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2BF3/c3-1(4)2(5)6.
What are the key properties of CID 18458589?
CID 18458589 has a molecular weight of 91.83 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18458589 is sourced from PubChem (CID 18458589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).