C2F6-2 — CID 157320683
1,1,2,2-tetrafluoroethene difluoride (PubChem CID 157320683) has the molecular formula C2F6-2 and a molecular weight of 138.01 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoroethene difluoride.
| Compound Name | 1,1,2,2-tetrafluoroethene difluoride |
|---|---|
| PubChem CID | 157320683 |
| Molecular Formula | C2F6-2 |
| Molecular Weight | 138.01 g/mol |
| Exact Mass | 137.99 |
| IUPAC Name | 1,1,2,2-tetrafluoroethene difluoride |
| SMILES | FC(F)=C(F)F.[F-].[F-] |
| InChI | InChI=1S/C2F4.2FH/c3-1(4)2(5)6;;/h;2*1H/p-2 |
| InChIKey | BECYHKVXLKDVGZ-UHFFFAOYSA-L |
| XLogP | -4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.01 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |