C5H7ClF2 — CID 23384792
2-chloro-1,1-difluoro-3-methylbut-1-ene (PubChem CID 23384792) has the molecular formula C5H7ClF2 and a molecular weight of 140.56 g/mol. Its IUPAC name is 2-chloro-1,1-difluoro-3-methylbut-1-ene.
| Compound Name | 2-chloro-1,1-difluoro-3-methylbut-1-ene |
|---|---|
| PubChem CID | 23384792 |
| Molecular Formula | C5H7ClF2 |
| Molecular Weight | 140.56 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | 2-chloro-1,1-difluoro-3-methylbut-1-ene |
| SMILES | CC(C)C(Cl)=C(F)F |
| InChI | InChI=1S/C5H7ClF2/c1-3(2)4(6)5(7)8/h3H,1-2H3 |
| InChIKey | XZCDFQLLMQWXDS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |