C10H13Cl2F — CID 155708974
(3Z,5Z)-3,4-dichloro-5-fluoro-6,7-dimethylocta-1,3,5-triene (PubChem CID 155708974) has the molecular formula C10H13Cl2F and a molecular weight of 223.12 g/mol. Its IUPAC name is (3Z,5Z)-3,4-dichloro-5-fluoro-6,7-dimethylocta-1,3,5-triene.
| Compound Name | (3Z,5Z)-3,4-dichloro-5-fluoro-6,7-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 155708974 |
| Molecular Formula | C10H13Cl2F |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (3Z,5Z)-3,4-dichloro-5-fluoro-6,7-dimethylocta-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(Cl)\C(F)=C(/C)C(C)C |
| InChI | InChI=1S/C10H13Cl2F/c1-5-8(11)9(12)10(13)7(4)6(2)3/h5-6H,1H2,2-4H3/b9-8-,10-7- |
| InChIKey | JNMIHGRCXZHVIN-NFIXMJHSSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|