C9H13FO — CID 143420580
(3Z)-3-ethenyl-4-fluoro-5-methylhexa-3,5-dien-2-ol (PubChem CID 143420580) has the molecular formula C9H13FO and a molecular weight of 156.20 g/mol. Its IUPAC name is (3Z)-3-ethenyl-4-fluoro-5-methylhexa-3,5-dien-2-ol.
| Compound Name | (3Z)-3-ethenyl-4-fluoro-5-methylhexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 143420580 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (3Z)-3-ethenyl-4-fluoro-5-methylhexa-3,5-dien-2-ol |
| SMILES | C=C/C(=C(/F)C(=C)C)C(C)O |
| InChI | InChI=1S/C9H13FO/c1-5-8(7(4)11)9(10)6(2)3/h5,7,11H,1-2H2,3-4H3/b9-8- |
| InChIKey | VSRKGHJZNMIDEQ-HJWRWDBZSA-N |
| XLogP | 2.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|