C8H8F4O — CID 145431433
(3Z)-3-fluoro-2-methyl-4-(trifluoromethoxy)hexa-1,3,5-triene (PubChem CID 145431433) has the molecular formula C8H8F4O and a molecular weight of 196.14 g/mol. Its IUPAC name is (3Z)-3-fluoro-2-methyl-4-(trifluoromethoxy)hexa-1,3,5-triene.
| Compound Name | (3Z)-3-fluoro-2-methyl-4-(trifluoromethoxy)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 145431433 |
| Molecular Formula | C8H8F4O |
| Molecular Weight | 196.14 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (3Z)-3-fluoro-2-methyl-4-(trifluoromethoxy)hexa-1,3,5-triene |
| SMILES | C=C/C(OC(F)(F)F)=C(/F)C(=C)C |
| InChI | InChI=1S/C8H8F4O/c1-4-6(7(9)5(2)3)13-8(10,11)12/h4H,1-2H2,3H3/b7-6- |
| InChIKey | PMVUTOGHPPVQNP-SREVYHEPSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|