C9H13FO — CID 145340423
(3E)-4-ethoxy-2-fluoro-3-methylhexa-1,3,5-triene (PubChem CID 145340423) has the molecular formula C9H13FO and a molecular weight of 156.20 g/mol. Its IUPAC name is (3E)-4-ethoxy-2-fluoro-3-methylhexa-1,3,5-triene.
| Compound Name | (3E)-4-ethoxy-2-fluoro-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 145340423 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (3E)-4-ethoxy-2-fluoro-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C(OCC)=C(/C)C(=C)F |
| InChI | InChI=1S/C9H13FO/c1-5-9(11-6-2)7(3)8(4)10/h5H,1,4,6H2,2-3H3/b9-7+ |
| InChIKey | ILLSSHGKTGDWSJ-VQHVLOKHSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|