C9H16O2 — CID 19609192
1,1-diethoxy-2-methylbuta-1,3-diene (PubChem CID 19609192) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 1,1-diethoxy-2-methylbuta-1,3-diene.
| Compound Name | 1,1-diethoxy-2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 19609192 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 1,1-diethoxy-2-methylbuta-1,3-diene |
| SMILES | C=CC(C)=C(OCC)OCC |
| InChI | InChI=1S/C9H16O2/c1-5-8(4)9(10-6-2)11-7-3/h5H,1,6-7H2,2-4H3 |
| InChIKey | CENJFYIBPYFFAA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|