C13H26GeO — CID 11630412
[(1Z)-1-ethoxy-2-methylbuta-1,3-dienyl]-triethylgermane (PubChem CID 11630412) has the molecular formula C13H26GeO and a molecular weight of 270.96 g/mol. Its IUPAC name is [(1Z)-1-ethoxy-2-methylbuta-1,3-dienyl]-triethylgermane.
| Compound Name | [(1Z)-1-ethoxy-2-methylbuta-1,3-dienyl]-triethylgermane |
|---|---|
| PubChem CID | 11630412 |
| Molecular Formula | C13H26GeO |
| Molecular Weight | 270.96 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [(1Z)-1-ethoxy-2-methylbuta-1,3-dienyl]-triethylgermane |
| SMILES | C=C/C(C)=C(/OCC)[Ge](CC)(CC)CC |
| InChI | InChI=1S/C13H26GeO/c1-7-12(6)13(15-11-5)14(8-2,9-3)10-4/h7H,1,8-11H2,2-6H3/b13-12+ |
| InChIKey | WYNMYZBANXZWFY-OUKQBFOZSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.96 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|