C7H12O2 — CID 11116083
1,1-dimethoxy-2-methylbuta-1,3-diene (PubChem CID 11116083) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 1,1-dimethoxy-2-methylbuta-1,3-diene.
| Compound Name | 1,1-dimethoxy-2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 11116083 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 1,1-dimethoxy-2-methylbuta-1,3-diene |
| SMILES | C=CC(C)=C(OC)OC |
| InChI | InChI=1S/C7H12O2/c1-5-6(2)7(8-3)9-4/h5H,1H2,2-4H3 |
| InChIKey | FQEOZNRVUYVLRO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|