C10H19NO — CID 143608728
N-[(1E)-1-methoxy-2-methylbuta-1,3-dienyl]methanimine;propane (PubChem CID 143608728) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N-[(1E)-1-methoxy-2-methylbuta-1,3-dienyl]methanimine;propane.
| Compound Name | N-[(1E)-1-methoxy-2-methylbuta-1,3-dienyl]methanimine;propane |
|---|---|
| PubChem CID | 143608728 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-[(1E)-1-methoxy-2-methylbuta-1,3-dienyl]methanimine;propane |
| SMILES | C=C/C(C)=C(\N=C)OC.CCC |
| InChI | InChI=1S/C7H11NO.C3H8/c1-5-6(2)7(8-3)9-4;1-3-2/h5H,1,3H2,2,4H3;3H2,1-2H3/b7-6+; |
| InChIKey | XZLYJWUNINJWQB-UHDJGPCESA-N |
| XLogP | 3.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|