C9H15NO — CID 166874510
N-[(2Z,4E)-5-methoxy-4-methylhexa-2,4-dien-2-yl]methanimine (PubChem CID 166874510) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N-[(2Z,4E)-5-methoxy-4-methylhexa-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2Z,4E)-5-methoxy-4-methylhexa-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 166874510 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-[(2Z,4E)-5-methoxy-4-methylhexa-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(C)=C\C(C)=C(/C)OC |
| InChI | InChI=1S/C9H15NO/c1-7(9(3)11-5)6-8(2)10-4/h6H,4H2,1-3,5H3/b8-6-,9-7+ |
| InChIKey | CTLQFZHTHJLIMW-MKKAVFGOSA-N |
| XLogP | 2.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|