C13H22O2 — CID 139497248
(5Z,7E)-5-ethyl-8-methoxy-7-methylnona-3,5,7-trien-2-ol (PubChem CID 139497248) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (5Z,7E)-5-ethyl-8-methoxy-7-methylnona-3,5,7-trien-2-ol.
| Compound Name | (5Z,7E)-5-ethyl-8-methoxy-7-methylnona-3,5,7-trien-2-ol |
|---|---|
| PubChem CID | 139497248 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (5Z,7E)-5-ethyl-8-methoxy-7-methylnona-3,5,7-trien-2-ol |
| SMILES | CC/C(C=CC(C)O)=C/C(C)=C(\C)OC |
| InChI | InChI=1S/C13H22O2/c1-6-13(8-7-11(3)14)9-10(2)12(4)15-5/h7-9,11,14H,6H2,1-5H3/b8-7?,12-10+,13-9- |
| InChIKey | CDGCGESIIATGRH-WEDVVETLSA-N |
| XLogP | 3.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|