C19H34O — CID 123438047
6-tert-butyl-5-ethenyl-2-methoxy-3,8,8-trimethylnona-2,4-diene (PubChem CID 123438047) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is 6-tert-butyl-5-ethenyl-2-methoxy-3,8,8-trimethylnona-2,4-diene.
| Compound Name | 6-tert-butyl-5-ethenyl-2-methoxy-3,8,8-trimethylnona-2,4-diene |
|---|---|
| PubChem CID | 123438047 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 6-tert-butyl-5-ethenyl-2-methoxy-3,8,8-trimethylnona-2,4-diene |
| SMILES | C=CC(=CC(C)=C(C)OC)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H34O/c1-11-16(12-14(2)15(3)20-10)17(19(7,8)9)13-18(4,5)6/h11-12,17H,1,13H2,2-10H3 |
| InChIKey | NWPUYIBFYSNMTO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|