C14H23N — CID 155109514
(2E,4Z)-3-methyl-5-propan-2-yl-N-prop-1-en-2-ylhepta-2,4,6-trien-2-amine (PubChem CID 155109514) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (2E,4Z)-3-methyl-5-propan-2-yl-N-prop-1-en-2-ylhepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z)-3-methyl-5-propan-2-yl-N-prop-1-en-2-ylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 155109514 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (2E,4Z)-3-methyl-5-propan-2-yl-N-prop-1-en-2-ylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C(C)=C(/C)NC(=C)C)C(C)C |
| InChI | InChI=1S/C14H23N/c1-8-14(10(2)3)9-12(6)13(7)15-11(4)5/h8-10,15H,1,4H2,2-3,5-7H3/b13-12+,14-9+ |
| InChIKey | BHJZATVTPZQUAE-WIVVVKQNSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|