C22H32N2 — CID 143431934
(3Z,7Z)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-amine;(3Z)-4-propan-2-ylhexa-1,3,5-trien-2-amine (PubChem CID 143431934) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is (3Z,7Z)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-amine;(3Z)-4-propan-2-ylhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z,7Z)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-amine;(3Z)-4-propan-2-ylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143431934 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | (3Z,7Z)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-amine;(3Z)-4-propan-2-ylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C\C(=C)N.C=C/C(=C\C(=C)N)C(C)C |
| InChI | InChI=1S/C13H17N.C9H15N/c1-10(2)6-7-11(3)12(4)8-9-13(5)14;1-5-9(7(2)3)6-8(4)10/h6-9H,1,3-5,14H2,2H3;5-7H,1,4,10H2,2-3H3/b7-6-,9-8-;9-6+ |
| InChIKey | SHZAZHMGCVYVJT-UJSWEYLBSA-N |
| XLogP | 5.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|