C8H11NO — CID 134431459
(4Z)-6-amino-3-methylidenehepta-4,6-dien-2-one (PubChem CID 134431459) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (4Z)-6-amino-3-methylidenehepta-4,6-dien-2-one.
| Compound Name | (4Z)-6-amino-3-methylidenehepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 134431459 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (4Z)-6-amino-3-methylidenehepta-4,6-dien-2-one |
| SMILES | C=C(N)/C=C\C(=C)C(C)=O |
| InChI | InChI=1S/C8H11NO/c1-6(8(3)10)4-5-7(2)9/h4-5H,1-2,9H2,3H3/b5-4- |
| InChIKey | AIWBAZDRJQZCSV-PLNGDYQASA-N |
| XLogP | 1.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|