C10H11NO — CID 138502287
(Z,2E)-2-ethylidene-5-methylidene-6-oxohept-3-enenitrile (PubChem CID 138502287) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-5-methylidene-6-oxohept-3-enenitrile.
| Compound Name | (Z,2E)-2-ethylidene-5-methylidene-6-oxohept-3-enenitrile |
|---|---|
| PubChem CID | 138502287 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (Z,2E)-2-ethylidene-5-methylidene-6-oxohept-3-enenitrile |
| SMILES | C=C(/C=C\C(C#N)=C/C)C(C)=O |
| InChI | InChI=1S/C10H11NO/c1-4-10(7-11)6-5-8(2)9(3)12/h4-6H,2H2,1,3H3/b6-5-,10-4+ |
| InChIKey | YWLLOBJYBVALEH-QYONPMAVSA-N |
| XLogP | 2.16 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|