C9H9NO2 — CID 142115713
(3E)-4-acetyl-5-hydroxy-2-methylidenehexa-3,5-dienenitrile (PubChem CID 142115713) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is (3E)-4-acetyl-5-hydroxy-2-methylidenehexa-3,5-dienenitrile.
| Compound Name | (3E)-4-acetyl-5-hydroxy-2-methylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142115713 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (3E)-4-acetyl-5-hydroxy-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(\C(=C)O)C(C)=O |
| InChI | InChI=1S/C9H9NO2/c1-6(5-10)4-9(7(2)11)8(3)12/h4,11H,1-2H2,3H3/b9-4+ |
| InChIKey | FAPVHKCLYYMPQI-RUDMXATFSA-N |
| XLogP | 1.65 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|