C10H13NO2 — CID 145007766
formaldehyde;(3E)-4-methoxy-5-methyl-2-methylidenehexa-3,5-dienenitrile (PubChem CID 145007766) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is formaldehyde;(3E)-4-methoxy-5-methyl-2-methylidenehexa-3,5-dienenitrile.
| Compound Name | formaldehyde;(3E)-4-methoxy-5-methyl-2-methylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 145007766 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | formaldehyde;(3E)-4-methoxy-5-methyl-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(/OC)C(=C)C.C=O |
| InChI | InChI=1S/C9H11NO.CH2O/c1-7(2)9(11-4)5-8(3)6-10;1-2/h5H,1,3H2,2,4H3;1H2/b9-5+; |
| InChIKey | VNLPRDRIUSYTCQ-SZKNIZGXSA-N |
| XLogP | 1.99 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|