C9H8N2O2 — CID 142452029
[(3E)-4-cyanato-5-methylhexa-1,3,5-trien-2-yl] cyanate (PubChem CID 142452029) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is [(3E)-4-cyanato-5-methylhexa-1,3,5-trien-2-yl] cyanate.
| Compound Name | [(3E)-4-cyanato-5-methylhexa-1,3,5-trien-2-yl] cyanate |
|---|---|
| PubChem CID | 142452029 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | [(3E)-4-cyanato-5-methylhexa-1,3,5-trien-2-yl] cyanate |
| SMILES | C=C(/C=C(/OC#N)C(=C)C)OC#N |
| InChI | InChI=1S/C9H8N2O2/c1-7(2)9(13-6-11)4-8(3)12-5-10/h4H,1,3H2,2H3/b9-4+ |
| InChIKey | UGFZGNLKSYLQNU-RUDMXATFSA-N |
| XLogP | 1.96 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|