About cyano 2-methylbut-2-enoate
cyano 2-methylbut-2-enoate (PubChem CID 154195789) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is cyano 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | cyano 2-methylbut-2-enoate |
| PubChem CID | 154195789 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | cyano 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC#N |
| InChI | InChI=1S/C6H7NO2/c1-3-5(2)6(8)9-4-7/h3H,1-2H3 |
| InChIKey | SOKCQEGUQQOWDM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyano 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano 2-methylbut-2-enoate?
The IUPAC name of cyano 2-methylbut-2-enoate (CID 154195789) is cyano 2-methylbut-2-enoate.
What is the SMILES notation for cyano 2-methylbut-2-enoate?
The canonical SMILES for cyano 2-methylbut-2-enoate is CC=C(C)C(=O)OC#N.
What is the InChIKey of cyano 2-methylbut-2-enoate?
The InChIKey is SOKCQEGUQQOWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c1-3-5(2)6(8)9-4-7/h3H,1-2H3.
What are the key properties of cyano 2-methylbut-2-enoate?
cyano 2-methylbut-2-enoate has a molecular weight of 125.13 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyano 2-methylbut-2-enoate is sourced from PubChem (CID 154195789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).