About (cyanoamino) 2-methylbut-2-enoate
(cyanoamino) 2-methylbut-2-enoate (PubChem CID 57277812) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is (cyanoamino) 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | (cyanoamino) 2-methylbut-2-enoate |
| PubChem CID | 57277812 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | (cyanoamino) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)ONC#N |
| InChI | InChI=1S/C6H8N2O2/c1-3-5(2)6(9)10-8-4-7/h3,8H,1-2H3 |
| InChIKey | YQVXLSGLCSRVHK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cyanoamino) 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyanoamino) 2-methylbut-2-enoate?
The IUPAC name of (cyanoamino) 2-methylbut-2-enoate (CID 57277812) is (cyanoamino) 2-methylbut-2-enoate.
What is the SMILES notation for (cyanoamino) 2-methylbut-2-enoate?
The canonical SMILES for (cyanoamino) 2-methylbut-2-enoate is CC=C(C)C(=O)ONC#N.
What is the InChIKey of (cyanoamino) 2-methylbut-2-enoate?
The InChIKey is YQVXLSGLCSRVHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-3-5(2)6(9)10-8-4-7/h3,8H,1-2H3.
What are the key properties of (cyanoamino) 2-methylbut-2-enoate?
(cyanoamino) 2-methylbut-2-enoate has a molecular weight of 140.14 g/mol, XLogP of 0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (cyanoamino) 2-methylbut-2-enoate is sourced from PubChem (CID 57277812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).