About calcium;(cyanoamino) hydrogen carbonate;hydride
calcium;(cyanoamino) hydrogen carbonate;hydride (PubChem CID 174912047) has the molecular formula C2H4CaN2O3
and a molecular weight of 144.14 g/mol. Its IUPAC name is calcium;(cyanoamino) hydrogen carbonate;hydride.
Molecular Properties
| Compound Name | calcium;(cyanoamino) hydrogen carbonate;hydride |
| PubChem CID | 174912047 |
| Molecular Formula | C2H4CaN2O3 |
| Molecular Weight | 144.14 g/mol |
| Exact Mass | 143.98 |
| IUPAC Name | calcium;(cyanoamino) hydrogen carbonate;hydride |
| SMILES | N#CNOC(=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C2H2N2O3.Ca.2H/c3-1-4-7-2(5)6;;;/h4H,(H,5,6);;;/q;+2;2*-1 |
| InChIKey | XUMUHDUCJVMENT-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.14 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium;(cyanoamino) hydrogen carbonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;(cyanoamino) hydrogen carbonate;hydride?
The IUPAC name of calcium;(cyanoamino) hydrogen carbonate;hydride (CID 174912047) is calcium;(cyanoamino) hydrogen carbonate;hydride.
What is the SMILES notation for calcium;(cyanoamino) hydrogen carbonate;hydride?
The canonical SMILES for calcium;(cyanoamino) hydrogen carbonate;hydride is N#CNOC(=O)O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;(cyanoamino) hydrogen carbonate;hydride?
The InChIKey is XUMUHDUCJVMENT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2N2O3.Ca.2H/c3-1-4-7-2(5)6;;;/h4H,(H,5,6);;;/q;+2;2*-1.
What are the key properties of calcium;(cyanoamino) hydrogen carbonate;hydride?
calcium;(cyanoamino) hydrogen carbonate;hydride has a molecular weight of 144.14 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;(cyanoamino) hydrogen carbonate;hydride is sourced from PubChem (CID 174912047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).