About dicalcium;carboxy hydrogen carbonate;hydride
dicalcium;carboxy hydrogen carbonate;hydride (PubChem CID 174530537) has the molecular formula C2H6Ca2O5
and a molecular weight of 190.22 g/mol. Its IUPAC name is dicalcium;carboxy hydrogen carbonate;hydride.
Molecular Properties
| Compound Name | dicalcium;carboxy hydrogen carbonate;hydride |
| PubChem CID | 174530537 |
| Molecular Formula | C2H6Ca2O5 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 189.95 |
| IUPAC Name | dicalcium;carboxy hydrogen carbonate;hydride |
| SMILES | O=C(O)OC(=O)O.[Ca+2].[Ca+2].[H-].[H-].[H-].[H-] |
| InChI | InChI=1S/C2H2O5.2Ca.4H/c3-1(4)7-2(5)6;;;;;;/h(H,3,4)(H,5,6);;;;;;/q;2*+2;4*-1 |
| InChIKey | GHRBUPBZXJZDEH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dicalcium;carboxy hydrogen carbonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;carboxy hydrogen carbonate;hydride?
The IUPAC name of dicalcium;carboxy hydrogen carbonate;hydride (CID 174530537) is dicalcium;carboxy hydrogen carbonate;hydride.
What is the SMILES notation for dicalcium;carboxy hydrogen carbonate;hydride?
The canonical SMILES for dicalcium;carboxy hydrogen carbonate;hydride is O=C(O)OC(=O)O.[Ca+2].[Ca+2].[H-].[H-].[H-].[H-].
What is the InChIKey of dicalcium;carboxy hydrogen carbonate;hydride?
The InChIKey is GHRBUPBZXJZDEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O5.2Ca.4H/c3-1(4)7-2(5)6;;;;;;/h(H,3,4)(H,5,6);;;;;;/q;2*+2;4*-1.
What are the key properties of dicalcium;carboxy hydrogen carbonate;hydride?
dicalcium;carboxy hydrogen carbonate;hydride has a molecular weight of 190.22 g/mol, XLogP of 0.05, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;carboxy hydrogen carbonate;hydride is sourced from PubChem (CID 174530537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).