About dicalcium;dicarboxy oxalate;hydride
dicalcium;dicarboxy oxalate;hydride (PubChem CID 173334486) has the molecular formula C4H6Ca2O8
and a molecular weight of 262.24 g/mol. Its IUPAC name is dicalcium;dicarboxy oxalate;hydride.
Molecular Properties
| Compound Name | dicalcium;dicarboxy oxalate;hydride |
| PubChem CID | 173334486 |
| Molecular Formula | C4H6Ca2O8 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 261.93 |
| IUPAC Name | dicalcium;dicarboxy oxalate;hydride |
| SMILES | O=C(O)OC(=O)C(=O)OC(=O)O.[Ca+2].[Ca+2].[H-].[H-].[H-].[H-] |
| InChI | InChI=1S/C4H2O8.2Ca.4H/c5-1(11-3(7)8)2(6)12-4(9)10;;;;;;/h(H,7,8)(H,9,10);;;;;;/q;2*+2;4*-1 |
| InChIKey | KUJYSFOFGKRVKY-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze dicalcium;dicarboxy oxalate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;dicarboxy oxalate;hydride?
The IUPAC name of dicalcium;dicarboxy oxalate;hydride (CID 173334486) is dicalcium;dicarboxy oxalate;hydride.
What is the SMILES notation for dicalcium;dicarboxy oxalate;hydride?
The canonical SMILES for dicalcium;dicarboxy oxalate;hydride is O=C(O)OC(=O)C(=O)OC(=O)O.[Ca+2].[Ca+2].[H-].[H-].[H-].[H-].
What is the InChIKey of dicalcium;dicarboxy oxalate;hydride?
The InChIKey is KUJYSFOFGKRVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O8.2Ca.4H/c5-1(11-3(7)8)2(6)12-4(9)10;;;;;;/h(H,7,8)(H,9,10);;;;;;/q;2*+2;4*-1.
What are the key properties of dicalcium;dicarboxy oxalate;hydride?
dicalcium;dicarboxy oxalate;hydride has a molecular weight of 262.24 g/mol, XLogP of -0.88, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;dicarboxy oxalate;hydride is sourced from PubChem (CID 173334486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).