About carboxy hydrogen carbonate;hydrochloride
carboxy hydrogen carbonate;hydrochloride (PubChem CID 141485807) has the molecular formula C2H3ClO5
and a molecular weight of 142.49 g/mol. Its IUPAC name is carboxy hydrogen carbonate;hydrochloride.
Molecular Properties
| Compound Name | carboxy hydrogen carbonate;hydrochloride |
| PubChem CID | 141485807 |
| Molecular Formula | C2H3ClO5 |
| Molecular Weight | 142.49 g/mol |
| Exact Mass | 141.97 |
| IUPAC Name | carboxy hydrogen carbonate;hydrochloride |
| SMILES | Cl.O=C(O)OC(=O)O |
| InChI | InChI=1S/C2H2O5.ClH/c3-1(4)7-2(5)6;/h(H,3,4)(H,5,6);1H |
| InChIKey | RRBCNMHXBOEPIX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.49 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze carboxy hydrogen carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxy hydrogen carbonate;hydrochloride?
The IUPAC name of carboxy hydrogen carbonate;hydrochloride (CID 141485807) is carboxy hydrogen carbonate;hydrochloride.
What is the SMILES notation for carboxy hydrogen carbonate;hydrochloride?
The canonical SMILES for carboxy hydrogen carbonate;hydrochloride is Cl.O=C(O)OC(=O)O.
What is the InChIKey of carboxy hydrogen carbonate;hydrochloride?
The InChIKey is RRBCNMHXBOEPIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O5.ClH/c3-1(4)7-2(5)6;/h(H,3,4)(H,5,6);1H.
What are the key properties of carboxy hydrogen carbonate;hydrochloride?
carboxy hydrogen carbonate;hydrochloride has a molecular weight of 142.49 g/mol, XLogP of 0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carboxy hydrogen carbonate;hydrochloride is sourced from PubChem (CID 141485807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).