About formonitrile;2-methylprop-2-enenitrile
formonitrile;2-methylprop-2-enenitrile (PubChem CID 174326031) has the molecular formula C5H6N2
and a molecular weight of 94.12 g/mol. Its IUPAC name is formonitrile;2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | formonitrile;2-methylprop-2-enenitrile |
| PubChem CID | 174326031 |
| Molecular Formula | C5H6N2 |
| Molecular Weight | 94.12 g/mol |
| Exact Mass | 94.05 |
| IUPAC Name | formonitrile;2-methylprop-2-enenitrile |
| SMILES | C#N.C=C(C)C#N |
| InChI | InChI=1S/C4H5N.CHN/c1-4(2)3-5;1-2/h1H2,2H3;1H |
| InChIKey | UTIOPEQYMNHFIK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.12 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze formonitrile;2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;2-methylprop-2-enenitrile?
The IUPAC name of formonitrile;2-methylprop-2-enenitrile (CID 174326031) is formonitrile;2-methylprop-2-enenitrile.
What is the SMILES notation for formonitrile;2-methylprop-2-enenitrile?
The canonical SMILES for formonitrile;2-methylprop-2-enenitrile is C#N.C=C(C)C#N.
What is the InChIKey of formonitrile;2-methylprop-2-enenitrile?
The InChIKey is UTIOPEQYMNHFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N.CHN/c1-4(2)3-5;1-2/h1H2,2H3;1H.
What are the key properties of formonitrile;2-methylprop-2-enenitrile?
formonitrile;2-methylprop-2-enenitrile has a molecular weight of 94.12 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;2-methylprop-2-enenitrile is sourced from PubChem (CID 174326031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).