About (E)-2,3-dimethylbut-2-enedinitrile;ethane
(E)-2,3-dimethylbut-2-enedinitrile;ethane (PubChem CID 145022966) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (E)-2,3-dimethylbut-2-enedinitrile;ethane.
Molecular Properties
| Compound Name | (E)-2,3-dimethylbut-2-enedinitrile;ethane |
| PubChem CID | 145022966 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (E)-2,3-dimethylbut-2-enedinitrile;ethane |
| SMILES | C/C(C#N)=C(/C)C#N.CC.CC |
| InChI | InChI=1S/C6H6N2.2C2H6/c1-5(3-7)6(2)4-8;2*1-2/h1-2H3;2*1-2H3/b6-5+;; |
| InChIKey | GETFHPAKWPNGFN-TXOOBNKBSA-N |
| XLogP | 3.42 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-dimethylbut-2-enedinitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-dimethylbut-2-enedinitrile;ethane?
The IUPAC name of (E)-2,3-dimethylbut-2-enedinitrile;ethane (CID 145022966) is (E)-2,3-dimethylbut-2-enedinitrile;ethane.
What is the SMILES notation for (E)-2,3-dimethylbut-2-enedinitrile;ethane?
The canonical SMILES for (E)-2,3-dimethylbut-2-enedinitrile;ethane is C/C(C#N)=C(/C)C#N.CC.CC.
What is the InChIKey of (E)-2,3-dimethylbut-2-enedinitrile;ethane?
The InChIKey is GETFHPAKWPNGFN-TXOOBNKBSA-N. The full InChI is InChI=1S/C6H6N2.2C2H6/c1-5(3-7)6(2)4-8;2*1-2/h1-2H3;2*1-2H3/b6-5+;;.
What are the key properties of (E)-2,3-dimethylbut-2-enedinitrile;ethane?
(E)-2,3-dimethylbut-2-enedinitrile;ethane has a molecular weight of 166.27 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-dimethylbut-2-enedinitrile;ethane is sourced from PubChem (CID 145022966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).