About sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile
sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile (PubChem CID 175260101) has the molecular formula C5H8NNaO
and a molecular weight of 121.11 g/mol. Its IUPAC name is sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile.
Molecular Properties
| Compound Name | sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile |
| PubChem CID | 175260101 |
| Molecular Formula | C5H8NNaO |
| Molecular Weight | 121.11 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile |
| SMILES | CC(O)=C(C)C#N.[H-].[Na+] |
| InChI | InChI=1S/C5H7NO.Na.H/c1-4(3-6)5(2)7;;/h7H,1-2H3;;/q;+1;-1 |
| InChIKey | LMMUYDQVSOKJPX-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.11 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile?
The IUPAC name of sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile (CID 175260101) is sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile.
What is the SMILES notation for sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile?
The canonical SMILES for sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile is CC(O)=C(C)C#N.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile?
The InChIKey is LMMUYDQVSOKJPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO.Na.H/c1-4(3-6)5(2)7;;/h7H,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile?
sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile has a molecular weight of 121.11 g/mol, XLogP of -1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-hydroxy-2-methylbut-2-enenitrile is sourced from PubChem (CID 175260101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).