About disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride
disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride (PubChem CID 173344541) has the molecular formula C4H4N2Na2S2
and a molecular weight of 190.20 g/mol. Its IUPAC name is disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride.
Molecular Properties
| Compound Name | disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride |
| PubChem CID | 173344541 |
| Molecular Formula | C4H4N2Na2S2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride |
| SMILES | N#CC(C#N)=C(S)S.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C4H2N2S2.2Na.2H/c5-1-3(2-6)4(7)8;;;;/h7-8H;;;;/q;2*+1;2*-1 |
| InChIKey | XPXFWDIKINXQIS-UHFFFAOYSA-N |
| XLogP | -4.66 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride?
The IUPAC name of disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride (CID 173344541) is disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride.
What is the SMILES notation for disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride?
The canonical SMILES for disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride is N#CC(C#N)=C(S)S.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride?
The InChIKey is XPXFWDIKINXQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N2S2.2Na.2H/c5-1-3(2-6)4(7)8;;;;/h7-8H;;;;/q;2*+1;2*-1.
What are the key properties of disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride?
disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride has a molecular weight of 190.20 g/mol, XLogP of -4.66, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-[bis(sulfanyl)methylidene]propanedinitrile;hydride is sourced from PubChem (CID 173344541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).