C5H2F2N2NaO+ — CID 22618505
sodium 2-(2,2-difluoro-1-hydroxyethylidene)propanedinitrile (PubChem CID 22618505) has the molecular formula C5H2F2N2NaO+ and a molecular weight of 167.07 g/mol. Its IUPAC name is sodium 2-(2,2-difluoro-1-hydroxyethylidene)propanedinitrile.
| Compound Name | sodium 2-(2,2-difluoro-1-hydroxyethylidene)propanedinitrile |
|---|---|
| PubChem CID | 22618505 |
| Molecular Formula | C5H2F2N2NaO+ |
| Molecular Weight | 167.07 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | sodium 2-(2,2-difluoro-1-hydroxyethylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C(O)C(F)F.[Na+] |
| InChI | InChI=1S/C5H2F2N2O.Na/c6-5(7)4(10)3(1-8)2-9;/h5,10H;/q;+1 |
| InChIKey | ZHXBYGFBLWYWML-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.07 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|