C6H2N4Na2 — CID 173357424
disodium;ethene-1,1,2,2-tetracarbonitrile;hydride (PubChem CID 173357424) has the molecular formula C6H2N4Na2 and a molecular weight of 176.09 g/mol. Its IUPAC name is disodium;ethene-1,1,2,2-tetracarbonitrile;hydride.
| Compound Name | disodium;ethene-1,1,2,2-tetracarbonitrile;hydride |
|---|---|
| PubChem CID | 173357424 |
| Molecular Formula | C6H2N4Na2 |
| Molecular Weight | 176.09 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | disodium;ethene-1,1,2,2-tetracarbonitrile;hydride |
| SMILES | N#CC(C#N)=C(C#N)C#N.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C6N4.2Na.2H/c7-1-5(2-8)6(3-9)4-10;;;;/q;2*+1;2*-1 |
| InChIKey | NDZKCSJSVGZOFI-UHFFFAOYSA-N |
| XLogP | -5.39 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.09 |
| LogP ≤ 5 | -5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|