About dipotassium;2,2-dicyanoethene-1,1-dithiolate
dipotassium;2,2-dicyanoethene-1,1-dithiolate (PubChem CID 19770836) has the molecular formula C4K2N2S2
and a molecular weight of 218.39 g/mol. Its IUPAC name is dipotassium;2,2-dicyanoethene-1,1-dithiolate.
Molecular Properties
| Compound Name | dipotassium;2,2-dicyanoethene-1,1-dithiolate |
| PubChem CID | 19770836 |
| Molecular Formula | C4K2N2S2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 217.88 |
| IUPAC Name | dipotassium;2,2-dicyanoethene-1,1-dithiolate |
| SMILES | N#CC(C#N)=C([S-])[S-].[K+].[K+] |
| InChI | InChI=1S/C4H2N2S2.2K/c5-1-3(2-6)4(7)8;;/h7-8H;;/q;2*+1/p-2 |
| InChIKey | IJJXVGPTSCPLMH-UHFFFAOYSA-L |
| XLogP | -5.65 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2,2-dicyanoethene-1,1-dithiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2,2-dicyanoethene-1,1-dithiolate?
The IUPAC name of dipotassium;2,2-dicyanoethene-1,1-dithiolate (CID 19770836) is dipotassium;2,2-dicyanoethene-1,1-dithiolate.
What is the SMILES notation for dipotassium;2,2-dicyanoethene-1,1-dithiolate?
The canonical SMILES for dipotassium;2,2-dicyanoethene-1,1-dithiolate is N#CC(C#N)=C([S-])[S-].[K+].[K+].
What is the InChIKey of dipotassium;2,2-dicyanoethene-1,1-dithiolate?
The InChIKey is IJJXVGPTSCPLMH-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H2N2S2.2K/c5-1-3(2-6)4(7)8;;/h7-8H;;/q;2*+1/p-2.
What are the key properties of dipotassium;2,2-dicyanoethene-1,1-dithiolate?
dipotassium;2,2-dicyanoethene-1,1-dithiolate has a molecular weight of 218.39 g/mol, XLogP of -5.65, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2,2-dicyanoethene-1,1-dithiolate is sourced from PubChem (CID 19770836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).