C4K2N2S2 — CID 19770836
dipotassium;2,2-dicyanoethene-1,1-dithiolate (PubChem CID 19770836) has the molecular formula C4K2N2S2 and a molecular weight of 218.39 g/mol. Its IUPAC name is dipotassium;2,2-dicyanoethene-1,1-dithiolate.
| Compound Name | dipotassium;2,2-dicyanoethene-1,1-dithiolate |
|---|---|
| PubChem CID | 19770836 |
| Molecular Formula | C4K2N2S2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 217.88 |
| IUPAC Name | dipotassium;2,2-dicyanoethene-1,1-dithiolate |
| SMILES | N#CC(C#N)=C([S-])[S-].[K+].[K+] |
| InChI | InChI=1S/C4H2N2S2.2K/c5-1-3(2-6)4(7)8;;/h7-8H;;/q;2*+1/p-2 |
| InChIKey | IJJXVGPTSCPLMH-UHFFFAOYSA-L |
| XLogP | -5.65 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|